C20H19FO3 — CID 6637605
(4aR,8R,8aS)-7-ethenyl-8-(3-fluoro-4-hydroxyphenyl)-3,8a-dimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 6637605) has the molecular formula C20H19FO3 and a molecular weight of 326.37 g/mol. Its IUPAC name is (4aR,8R,8aS)-7-ethenyl-8-(3-fluoro-4-hydroxyphenyl)-3,8a-dimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | (4aR,8R,8aS)-7-ethenyl-8-(3-fluoro-4-hydroxyphenyl)-3,8a-dimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 6637605 |
| Molecular Formula | C20H19FO3 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (4aR,8R,8aS)-7-ethenyl-8-(3-fluoro-4-hydroxyphenyl)-3,8a-dimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | C=CC1=CC[C@H]2C(=O)C(C)=CC(=O)[C@@]2(C)[C@H]1c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C20H19FO3/c1-4-12-5-7-14-19(24)11(2)9-17(23)20(14,3)18(12)13-6-8-16(22)15(21)10-13/h4-6,8-10,14,18,22H,1,7H2,2-3H3/t14-,18+,20-/m0/s1 |
| InChIKey | PDRSZZWHQPNRQJ-QMIHWGKISA-N |
| XLogP | 3.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |