C13H14ClNO2 — CID 66460338
2-[2-chloro-2-(oxolan-3-yl)ethyl]-1,3-benzoxazole (PubChem CID 66460338) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 2-[2-chloro-2-(oxolan-3-yl)ethyl]-1,3-benzoxazole.
| Compound Name | 2-[2-chloro-2-(oxolan-3-yl)ethyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 66460338 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-[2-chloro-2-(oxolan-3-yl)ethyl]-1,3-benzoxazole |
| SMILES | ClC(Cc1nc2ccccc2o1)C1CCOC1 |
| InChI | InChI=1S/C13H14ClNO2/c14-10(9-5-6-16-8-9)7-13-15-11-3-1-2-4-12(11)17-13/h1-4,9-10H,5-8H2 |
| InChIKey | SOSDZXFRGYPVAU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|