C12H16N4O3 — CID 66486752
[3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methanamine (PubChem CID 66486752) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is [3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methanamine.
| Compound Name | [3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methanamine |
|---|---|
| PubChem CID | 66486752 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | [3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-5-yl]methanamine |
| SMILES | COc1cc(-c2n[nH]c(CN)n2)cc(OC)c1OC |
| InChI | InChI=1S/C12H16N4O3/c1-17-8-4-7(5-9(18-2)11(8)19-3)12-14-10(6-13)15-16-12/h4-5H,6,13H2,1-3H3,(H,14,15,16) |
| InChIKey | UKGMZWWSIONAJA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |