C4H8N4O — CID 83872219
(3-methoxy-1H-1,2,4-triazol-5-yl)methanamine (PubChem CID 83872219) has the molecular formula C4H8N4O and a molecular weight of 128.13 g/mol. Its IUPAC name is (3-methoxy-1H-1,2,4-triazol-5-yl)methanamine.
| Compound Name | (3-methoxy-1H-1,2,4-triazol-5-yl)methanamine |
|---|---|
| PubChem CID | 83872219 |
| Molecular Formula | C4H8N4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | (3-methoxy-1H-1,2,4-triazol-5-yl)methanamine |
| SMILES | COc1n[nH]c(CN)n1 |
| InChI | InChI=1S/C4H8N4O/c1-9-4-6-3(2-5)7-8-4/h2,5H2,1H3,(H,6,7,8) |
| InChIKey | HLANAZYJSFPKJV-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |