C4H7N3O2 — CID 539449
3,5-dimethoxy-1H-1,2,4-triazole (PubChem CID 539449) has the molecular formula C4H7N3O2 and a molecular weight of 129.12 g/mol. Its IUPAC name is 3,5-dimethoxy-1H-1,2,4-triazole.
| Compound Name | 3,5-dimethoxy-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 539449 |
| Molecular Formula | C4H7N3O2 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | 3,5-dimethoxy-1H-1,2,4-triazole |
| SMILES | COc1n[nH]c(OC)n1 |
| InChI | InChI=1S/C4H7N3O2/c1-8-3-5-4(9-2)7-6-3/h1-2H3,(H,5,6,7) |
| InChIKey | YJOYZLCIMKYAIJ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |