C10H12F3NO2 — CID 66510272
2-[(1S)-1-amino-2,2,2-trifluoroethyl]-4-ethoxyphenol (PubChem CID 66510272) has the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2,2,2-trifluoroethyl]-4-ethoxyphenol.
| Compound Name | 2-[(1S)-1-amino-2,2,2-trifluoroethyl]-4-ethoxyphenol |
|---|---|
| PubChem CID | 66510272 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-[(1S)-1-amino-2,2,2-trifluoroethyl]-4-ethoxyphenol |
| SMILES | CCOc1ccc(O)c([C@H](N)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3NO2/c1-2-16-6-3-4-8(15)7(5-6)9(14)10(11,12)13/h3-5,9,15H,2,14H2,1H3/t9-/m0/s1 |
| InChIKey | KWFYUMUUIQTTII-VIFPVBQESA-N |
| XLogP | 2.35 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|