C12H15BrF3NO2 — CID 66510411
(1S)-1-(3-bromo-4,5-diethoxyphenyl)-2,2,2-trifluoroethanamine (PubChem CID 66510411) has the molecular formula C12H15BrF3NO2 and a molecular weight of 342.16 g/mol. Its IUPAC name is (1S)-1-(3-bromo-4,5-diethoxyphenyl)-2,2,2-trifluoroethanamine.
| Compound Name | (1S)-1-(3-bromo-4,5-diethoxyphenyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 66510411 |
| Molecular Formula | C12H15BrF3NO2 |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | (1S)-1-(3-bromo-4,5-diethoxyphenyl)-2,2,2-trifluoroethanamine |
| SMILES | CCOc1cc([C@H](N)C(F)(F)F)cc(Br)c1OCC |
| InChI | InChI=1S/C12H15BrF3NO2/c1-3-18-9-6-7(11(17)12(14,15)16)5-8(13)10(9)19-4-2/h5-6,11H,3-4,17H2,1-2H3/t11-/m0/s1 |
| InChIKey | NBFHULSTAKKFEP-NSHDSACASA-N |
| XLogP | 3.81 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |