C21H29FN2O3 — CID 66523359
tert-butyl 4-[(E)-3-(dimethylamino)prop-2-enoyl]-4-(4-fluorophenyl)piperidine-1-carboxylate (PubChem CID 66523359) has the molecular formula C21H29FN2O3 and a molecular weight of 376.47 g/mol. Its IUPAC name is tert-butyl 4-[(E)-3-(dimethylamino)prop-2-enoyl]-4-(4-fluorophenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(E)-3-(dimethylamino)prop-2-enoyl]-4-(4-fluorophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66523359 |
| Molecular Formula | C21H29FN2O3 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | tert-butyl 4-[(E)-3-(dimethylamino)prop-2-enoyl]-4-(4-fluorophenyl)piperidine-1-carboxylate |
| SMILES | CN(C)/C=C/C(=O)C1(c2ccc(F)cc2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H29FN2O3/c1-20(2,3)27-19(26)24-14-11-21(12-15-24,18(25)10-13-23(4)5)16-6-8-17(22)9-7-16/h6-10,13H,11-12,14-15H2,1-5H3/b13-10+ |
| InChIKey | SDYSZYJGXMZDFC-JLHYYAGUSA-N |
| XLogP | 3.74 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|