About [3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane
[3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane (PubChem CID 66523602) has the molecular formula C7H5Br2F5S
and a molecular weight of 375.98 g/mol. Its IUPAC name is [3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane.
Molecular Properties
| Compound Name | [3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane |
| PubChem CID | 66523602 |
| Molecular Formula | C7H5Br2F5S |
| Molecular Weight | 375.98 g/mol |
| Exact Mass | 373.84 |
| IUPAC Name | [3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane |
| SMILES | FS(F)(F)(F)(F)c1cc(Br)cc(CBr)c1 |
| InChI | InChI=1S/C7H5Br2F5S/c8-4-5-1-6(9)3-7(2-5)15(10,11,12,13)14/h1-3H,4H2 |
| InChIKey | PSRNYAZILJJJGP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.98 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane?
The IUPAC name of [3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane (CID 66523602) is [3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane.
What is the SMILES notation for [3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane?
The canonical SMILES for [3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane is FS(F)(F)(F)(F)c1cc(Br)cc(CBr)c1.
What is the InChIKey of [3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane?
The InChIKey is PSRNYAZILJJJGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Br2F5S/c8-4-5-1-6(9)3-7(2-5)15(10,11,12,13)14/h1-3H,4H2.
What are the key properties of [3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane?
[3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane has a molecular weight of 375.98 g/mol, XLogP of 6.00, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [3-bromo-5-(bromomethyl)phenyl]-pentafluoro-λ6-sulfane is sourced from PubChem (CID 66523602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).