C14H16O4 — CID 66556677
(1R,10R,13S)-13-methyl-9,14,15,17-tetraoxatetracyclo[11.2.2.01,10.02,7]heptadeca-2,4,6-triene (PubChem CID 66556677) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (1R,10R,13S)-13-methyl-9,14,15,17-tetraoxatetracyclo[11.2.2.01,10.02,7]heptadeca-2,4,6-triene.
| Compound Name | (1R,10R,13S)-13-methyl-9,14,15,17-tetraoxatetracyclo[11.2.2.01,10.02,7]heptadeca-2,4,6-triene |
|---|---|
| PubChem CID | 66556677 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (1R,10R,13S)-13-methyl-9,14,15,17-tetraoxatetracyclo[11.2.2.01,10.02,7]heptadeca-2,4,6-triene |
| SMILES | C[C@]12CC[C@H]3OCc4ccccc4[C@]3(CO1)OO2 |
| InChI | InChI=1S/C14H16O4/c1-13-7-6-12-14(9-16-13,18-17-13)11-5-3-2-4-10(11)8-15-12/h2-5,12H,6-9H2,1H3/t12-,13+,14+/m1/s1 |
| InChIKey | OSCNMWFYVYKLTD-RDBSUJKOSA-N |
| XLogP | 2.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|