C20H32O3Si — CID 66559535
(3'S,4R,4aS)-3'-[tert-butyl(dimethyl)silyl]oxy-1'-methylspiro[1,3,4a,5-tetrahydrocyclopenta[c]pyran-4,4'-cyclohexene]-6-one (PubChem CID 66559535) has the molecular formula C20H32O3Si and a molecular weight of 348.56 g/mol. Its IUPAC name is (3'S,4R,4aS)-3'-[tert-butyl(dimethyl)silyl]oxy-1'-methylspiro[1,3,4a,5-tetrahydrocyclopenta[c]pyran-4,4'-cyclohexene]-6-one.
| Compound Name | (3'S,4R,4aS)-3'-[tert-butyl(dimethyl)silyl]oxy-1'-methylspiro[1,3,4a,5-tetrahydrocyclopenta[c]pyran-4,4'-cyclohexene]-6-one |
|---|---|
| PubChem CID | 66559535 |
| Molecular Formula | C20H32O3Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (3'S,4R,4aS)-3'-[tert-butyl(dimethyl)silyl]oxy-1'-methylspiro[1,3,4a,5-tetrahydrocyclopenta[c]pyran-4,4'-cyclohexene]-6-one |
| SMILES | CC1=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(CC1)COCC1=CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C20H32O3Si/c1-14-7-8-20(13-22-12-15-10-16(21)11-17(15)20)18(9-14)23-24(5,6)19(2,3)4/h9-10,17-18H,7-8,11-13H2,1-6H3/t17-,18-,20-/m0/s1 |
| InChIKey | QLUXMSOHQDFGIY-BJLQDIEVSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|