C20H35NO4 — CID 66563294
N-ethyl-2-[[(3Z,5R,6S,7S,8E)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl]oxy]acetamide (PubChem CID 66563294) has the molecular formula C20H35NO4 and a molecular weight of 353.50 g/mol. Its IUPAC name is N-ethyl-2-[[(3Z,5R,6S,7S,8E)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl]oxy]acetamide.
| Compound Name | N-ethyl-2-[[(3Z,5R,6S,7S,8E)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl]oxy]acetamide |
|---|---|
| PubChem CID | 66563294 |
| Molecular Formula | C20H35NO4 |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | N-ethyl-2-[[(3Z,5R,6S,7S,8E)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl]oxy]acetamide |
| SMILES | CCNC(=O)CO[C@H]1[C@H](C)/C=C(/C)COCCCCC/C=C/[C@@H]1OC |
| InChI | InChI=1S/C20H35NO4/c1-5-21-19(22)15-25-20-17(3)13-16(2)14-24-12-10-8-6-7-9-11-18(20)23-4/h9,11,13,17-18,20H,5-8,10,12,14-15H2,1-4H3,(H,21,22)/b11-9+,16-13-/t17-,18+,20+/m1/s1 |
| InChIKey | VWVAKWTVDSZHHD-GSLLBTJOSA-N |
| XLogP | 3.25 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|