C23H16N4O6 — CID 66571764
4-[[4-[4-(2-carboxyphenyl)phenyl]triazol-1-yl]methyl]-3-nitrobenzoic acid (PubChem CID 66571764) has the molecular formula C23H16N4O6 and a molecular weight of 444.40 g/mol. Its IUPAC name is 4-[[4-[4-(2-carboxyphenyl)phenyl]triazol-1-yl]methyl]-3-nitrobenzoic acid.
| Compound Name | 4-[[4-[4-(2-carboxyphenyl)phenyl]triazol-1-yl]methyl]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 66571764 |
| Molecular Formula | C23H16N4O6 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 4-[[4-[4-(2-carboxyphenyl)phenyl]triazol-1-yl]methyl]-3-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc(Cn2cc(-c3ccc(-c4ccccc4C(=O)O)cc3)nn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H16N4O6/c28-22(29)16-9-10-17(21(11-16)27(32)33)12-26-13-20(24-25-26)15-7-5-14(6-8-15)18-3-1-2-4-19(18)23(30)31/h1-11,13H,12H2,(H,28,29)(H,30,31) |
| InChIKey | YJEOSHSLFWMFMN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|