C21H32FN3O — CID 66590439
(2S)-2-[[(3aR,4S,6aS)-2-[(4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-4-methylpentanamide (PubChem CID 66590439) has the molecular formula C21H32FN3O and a molecular weight of 361.50 g/mol. Its IUPAC name is (2S)-2-[[(3aR,4S,6aS)-2-[(4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(3aR,4S,6aS)-2-[(4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 66590439 |
| Molecular Formula | C21H32FN3O |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | (2S)-2-[[(3aR,4S,6aS)-2-[(4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-methylamino]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](C(N)=O)N(C)[C@H]1CC[C@@H]2CN(Cc3ccc(F)cc3)C[C@@H]21 |
| InChI | InChI=1S/C21H32FN3O/c1-14(2)10-20(21(23)26)24(3)19-9-6-16-12-25(13-18(16)19)11-15-4-7-17(22)8-5-15/h4-5,7-8,14,16,18-20H,6,9-13H2,1-3H3,(H2,23,26)/t16-,18+,19+,20+/m1/s1 |
| InChIKey | OMZSHOXZCNMIMG-GTAWCEEGSA-N |
| XLogP | 2.87 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |