C20H28F3N3O — CID 66590899
(2S)-2-[[(3aR,4S,6aS)-2-[[4-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]pentanamide (PubChem CID 66590899) has the molecular formula C20H28F3N3O and a molecular weight of 383.46 g/mol. Its IUPAC name is (2S)-2-[[(3aR,4S,6aS)-2-[[4-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]pentanamide.
| Compound Name | (2S)-2-[[(3aR,4S,6aS)-2-[[4-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]pentanamide |
|---|---|
| PubChem CID | 66590899 |
| Molecular Formula | C20H28F3N3O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | (2S)-2-[[(3aR,4S,6aS)-2-[[4-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]pentanamide |
| SMILES | CCC[C@H](N[C@H]1CC[C@@H]2CN(Cc3ccc(C(F)(F)F)cc3)C[C@@H]21)C(N)=O |
| InChI | InChI=1S/C20H28F3N3O/c1-2-3-18(19(24)27)25-17-9-6-14-11-26(12-16(14)17)10-13-4-7-15(8-5-13)20(21,22)23/h4-5,7-8,14,16-18,25H,2-3,6,9-12H2,1H3,(H2,24,27)/t14-,16+,17+,18+/m1/s1 |
| InChIKey | VQWMZFWZLYXAIR-UBDQQSCGSA-N |
| XLogP | 3.16 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |