C18H23NO6 — CID 66598932
2-(2-methylprop-2-enoyloxy)ethyl 4-[2-(4-hydroxyphenyl)ethylamino]-4-oxobutanoate (PubChem CID 66598932) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 4-[2-(4-hydroxyphenyl)ethylamino]-4-oxobutanoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-[2-(4-hydroxyphenyl)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 66598932 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-[2-(4-hydroxyphenyl)ethylamino]-4-oxobutanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCC(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C18H23NO6/c1-13(2)18(23)25-12-11-24-17(22)8-7-16(21)19-10-9-14-3-5-15(20)6-4-14/h3-6,20H,1,7-12H2,2H3,(H,19,21) |
| InChIKey | WWGKJGLNHUKGOF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|