C23H28N+ — CID 66604762
(1R,5S)-3-(2,2-diphenylethenyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane (PubChem CID 66604762) has the molecular formula C23H28N+ and a molecular weight of 318.48 g/mol. Its IUPAC name is (1R,5S)-3-(2,2-diphenylethenyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-3-(2,2-diphenylethenyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 66604762 |
| Molecular Formula | C23H28N+ |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1R,5S)-3-(2,2-diphenylethenyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1CC(C=C(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C23H28N/c1-24(2)21-13-14-22(24)16-18(15-21)17-23(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,17-18,21-22H,13-16H2,1-2H3/q+1/t18?,21-,22+ |
| InChIKey | CTONCXSGQXCJCF-CZAFVFSZSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|