About 6-methyl-2-oxabicyclo[2.2.2]octa-1(6),4,7-triene
6-methyl-2-oxabicyclo[2.2.2]octa-1(6),4,7-triene (PubChem CID 66605650) has the molecular formula C8H8O
and a molecular weight of 120.15 g/mol. Its IUPAC name is 6-methyl-2-oxabicyclo[2.2.2]octa-1(6),4,7-triene.
Analyze 6-methyl-2-oxabicyclo[2.2.2]octa-1(6),4,7-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-oxabicyclo[2.2.2]octa-1(6),4,7-triene?
The IUPAC name of 6-methyl-2-oxabicyclo[2.2.2]octa-1(6),4,7-triene (CID 66605650) is 6-methyl-2-oxabicyclo[2.2.2]octa-1(6),4,7-triene.
What is the SMILES notation for 6-methyl-2-oxabicyclo[2.2.2]octa-1(6),4,7-triene?
The canonical SMILES for 6-methyl-2-oxabicyclo[2.2.2]octa-1(6),4,7-triene is Cc1cc2ccc1OC2.
What is the InChIKey of 6-methyl-2-oxabicyclo[2.2.2]octa-1(6),4,7-triene?
The InChIKey is CBAYNFSSZCOLAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O/c1-6-4-7-2-3-8(6)9-5-7/h2-4H,5H2,1H3.
What are the key properties of 6-methyl-2-oxabicyclo[2.2.2]octa-1(6),4,7-triene?
6-methyl-2-oxabicyclo[2.2.2]octa-1(6),4,7-triene has a molecular weight of 120.15 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-oxabicyclo[2.2.2]octa-1(6),4,7-triene is sourced from PubChem (CID 66605650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).