C22H22BrNO4 — CID 66606596
tert-butyl N-[1-(6-bromo-4-oxo-3-phenylchromen-2-yl)ethyl]carbamate (PubChem CID 66606596) has the molecular formula C22H22BrNO4 and a molecular weight of 444.33 g/mol. Its IUPAC name is tert-butyl N-[1-(6-bromo-4-oxo-3-phenylchromen-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(6-bromo-4-oxo-3-phenylchromen-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 66606596 |
| Molecular Formula | C22H22BrNO4 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | tert-butyl N-[1-(6-bromo-4-oxo-3-phenylchromen-2-yl)ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1oc2ccc(Br)cc2c(=O)c1-c1ccccc1 |
| InChI | InChI=1S/C22H22BrNO4/c1-13(24-21(26)28-22(2,3)4)20-18(14-8-6-5-7-9-14)19(25)16-12-15(23)10-11-17(16)27-20/h5-13H,1-4H3,(H,24,26) |
| InChIKey | BDKCLVRNXXEFCE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |