C12H14O — CID 66608734
1,2,3,4,4a,5a-hexahydrodibenzofuran (PubChem CID 66608734) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 1,2,3,4,4a,5a-hexahydrodibenzofuran.
| Compound Name | 1,2,3,4,4a,5a-hexahydrodibenzofuran |
|---|---|
| PubChem CID | 66608734 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 1,2,3,4,4a,5a-hexahydrodibenzofuran |
| SMILES | C1=CC2=C3CCCCC3OC2C=C1 |
| InChI | InChI=1S/C12H14O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1,3,5,7,11-12H,2,4,6,8H2 |
| InChIKey | GQUMDELLLVJFBA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |