C25H39N4O8P — CID 66609413
2-[2-[2-[[2-[4-[(2-amino-4-butoxy-6-methylpyrimidin-5-yl)methyl]-3-methoxyphenyl]acetyl]amino]ethoxy]ethoxy]ethylphosphonic acid (PubChem CID 66609413) has the molecular formula C25H39N4O8P and a molecular weight of 554.58 g/mol. Its IUPAC name is 2-[2-[2-[[2-[4-[(2-amino-4-butoxy-6-methylpyrimidin-5-yl)methyl]-3-methoxyphenyl]acetyl]amino]ethoxy]ethoxy]ethylphosphonic acid.
| Compound Name | 2-[2-[2-[[2-[4-[(2-amino-4-butoxy-6-methylpyrimidin-5-yl)methyl]-3-methoxyphenyl]acetyl]amino]ethoxy]ethoxy]ethylphosphonic acid |
|---|---|
| PubChem CID | 66609413 |
| Molecular Formula | C25H39N4O8P |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 2-[2-[2-[[2-[4-[(2-amino-4-butoxy-6-methylpyrimidin-5-yl)methyl]-3-methoxyphenyl]acetyl]amino]ethoxy]ethoxy]ethylphosphonic acid |
| SMILES | CCCCOc1nc(N)nc(C)c1Cc1ccc(CC(=O)NCCOCCOCCP(=O)(O)O)cc1OC |
| InChI | InChI=1S/C25H39N4O8P/c1-4-5-9-37-24-21(18(2)28-25(26)29-24)17-20-7-6-19(15-22(20)34-3)16-23(30)27-8-10-35-11-12-36-13-14-38(31,32)33/h6-7,15H,4-5,8-14,16-17H2,1-3H3,(H,27,30)(H2,26,28,29)(H2,31,32,33) |
| InChIKey | JHLJMFMHAOTTRR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 175.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|