C18H28O6 — CID 66615222
methyl 3-[(3aS,7aS)-1,5-diacetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]propanoate (PubChem CID 66615222) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is methyl 3-[(3aS,7aS)-1,5-diacetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]propanoate.
| Compound Name | methyl 3-[(3aS,7aS)-1,5-diacetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]propanoate |
|---|---|
| PubChem CID | 66615222 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | methyl 3-[(3aS,7aS)-1,5-diacetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]propanoate |
| SMILES | COC(=O)CCC1C(OC(C)=O)CC[C@]2(C)C(OC(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C18H28O6/c1-11(19)23-15-9-10-18(3)14(6-7-16(18)24-12(2)20)13(15)5-8-17(21)22-4/h13-16H,5-10H2,1-4H3/t13?,14-,15?,16?,18-/m0/s1 |
| InChIKey | WVGTYHJZLSEBJA-KVODCKKVSA-N |
| XLogP | 2.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|