C30H34Cl2N8O5 — CID 66629757
N-[(1S,2R,3S,4R)-4-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-[[2,2-bis(4-chlorophenyl)-2-hydroxyethyl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2-hydroxyacetamide (PubChem CID 66629757) has the molecular formula C30H34Cl2N8O5 and a molecular weight of 657.56 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-[[2,2-bis(4-chlorophenyl)-2-hydroxyethyl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2-hydroxyacetamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-[[2,2-bis(4-chlorophenyl)-2-hydroxyethyl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 66629757 |
| Molecular Formula | C30H34Cl2N8O5 |
| Molecular Weight | 657.56 g/mol |
| Exact Mass | 656.20 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-[[2,2-bis(4-chlorophenyl)-2-hydroxyethyl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2-hydroxyacetamide |
| SMILES | N[C@@H]1CCN(c2nc(NCC(O)(c3ccc(Cl)cc3)c3ccc(Cl)cc3)c3ncn([C@@H]4C[C@H](NC(=O)CO)[C@@H](O)[C@H]4O)c3n2)C1 |
| InChI | InChI=1S/C30H34Cl2N8O5/c31-18-5-1-16(2-6-18)30(45,17-3-7-19(32)8-4-17)14-34-27-24-28(38-29(37-27)39-10-9-20(33)12-39)40(15-35-24)22-11-21(25(43)26(22)44)36-23(42)13-41/h1-8,15,20-22,25-26,41,43-45H,9-14,33H2,(H,36,42)(H,34,37,38)/t20-,21+,22-,25-,26+/m1/s1 |
| InChIKey | HBFNINALSLZYGV-ZDLRPUJNSA-N |
| XLogP | 1.16 |
| TPSA | 194.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.56 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |