C19H22O2S — CID 66636845
3-(4-hydroxy-3,5-dimethylphenyl)-1-[5-(2-methylpropyl)thiophen-2-yl]prop-2-en-1-one (PubChem CID 66636845) has the molecular formula C19H22O2S and a molecular weight of 314.45 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethylphenyl)-1-[5-(2-methylpropyl)thiophen-2-yl]prop-2-en-1-one.
| Compound Name | 3-(4-hydroxy-3,5-dimethylphenyl)-1-[5-(2-methylpropyl)thiophen-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 66636845 |
| Molecular Formula | C19H22O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethylphenyl)-1-[5-(2-methylpropyl)thiophen-2-yl]prop-2-en-1-one |
| SMILES | Cc1cc(C=CC(=O)c2ccc(CC(C)C)s2)cc(C)c1O |
| InChI | InChI=1S/C19H22O2S/c1-12(2)9-16-6-8-18(22-16)17(20)7-5-15-10-13(3)19(21)14(4)11-15/h5-8,10-12,21H,9H2,1-4H3 |
| InChIKey | QCNVYYXKYHGEIQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|