C20H19NO5 — CID 170554760
2-[[4-[(E)-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enoyl]benzoyl]amino]acetic acid (PubChem CID 170554760) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is 2-[[4-[(E)-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enoyl]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[(E)-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enoyl]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 170554760 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-[[4-[(E)-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enoyl]benzoyl]amino]acetic acid |
| SMILES | Cc1cc(/C=C/C(=O)c2ccc(C(=O)NCC(=O)O)cc2)cc(C)c1O |
| InChI | InChI=1S/C20H19NO5/c1-12-9-14(10-13(2)19(12)25)3-8-17(22)15-4-6-16(7-5-15)20(26)21-11-18(23)24/h3-10,25H,11H2,1-2H3,(H,21,26)(H,23,24)/b8-3+ |
| InChIKey | HAQBCXZXJAJSDA-FPYGCLRLSA-N |
| XLogP | 2.72 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|