C18H18O3 — CID 15020307
(E)-4-(4-hydroxy-3,5-dimethylphenyl)-1-phenoxybut-3-en-2-one (PubChem CID 15020307) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (E)-4-(4-hydroxy-3,5-dimethylphenyl)-1-phenoxybut-3-en-2-one.
| Compound Name | (E)-4-(4-hydroxy-3,5-dimethylphenyl)-1-phenoxybut-3-en-2-one |
|---|---|
| PubChem CID | 15020307 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (E)-4-(4-hydroxy-3,5-dimethylphenyl)-1-phenoxybut-3-en-2-one |
| SMILES | Cc1cc(/C=C/C(=O)COc2ccccc2)cc(C)c1O |
| InChI | InChI=1S/C18H18O3/c1-13-10-15(11-14(2)18(13)20)8-9-16(19)12-21-17-6-4-3-5-7-17/h3-11,20H,12H2,1-2H3/b9-8+ |
| InChIKey | PHTGPMCMFOIAJR-CMDGGOBGSA-N |
| XLogP | 3.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|