C28H27N3O8 — CID 66642498
1-[2-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 66642498) has the molecular formula C28H27N3O8 and a molecular weight of 533.54 g/mol. Its IUPAC name is 1-[2-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[2-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 66642498 |
| Molecular Formula | C28H27N3O8 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 1-[2-(2'-oxospiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-1'-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NCCN2C(=O)C3(COc4cc5c(cc43)OCO5)c3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C28H27N3O8/c1-34-23-10-16(11-24(35-2)25(23)36-3)30-27(33)29-8-9-31-19-7-5-4-6-17(19)28(26(31)32)14-37-20-13-22-21(12-18(20)28)38-15-39-22/h4-7,10-13H,8-9,14-15H2,1-3H3,(H2,29,30,33) |
| InChIKey | BTUCCWZCWHMMBS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |