C22H40O8 — CID 66645202
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hexadecanoic acid (PubChem CID 66645202) has the molecular formula C22H40O8 and a molecular weight of 432.55 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hexadecanoic acid.
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hexadecanoic acid |
|---|---|
| PubChem CID | 66645202 |
| Molecular Formula | C22H40O8 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;hexadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCC(=O)O.O=C1O[C@H]([C@@H](O)CO)C(O)=C1O |
| InChI | InChI=1S/C16H32O2.C6H8O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;7-1-2(8)5-3(9)4(10)6(11)12-5/h2-15H2,1H3,(H,17,18);2,5,7-10H,1H2/t;2-,5+/m.0/s1 |
| InChIKey | PBTPTBMYJPCXRQ-MGMRMFRLSA-N |
| XLogP | 4.14 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|