C27H25N3O7 — CID 66657549
2-(carboxymethyl)-5-[(5-carboxy-2-pyridinyl)oxy]-1-[4-(diethylamino)phenyl]indole-3-carboxylic acid (PubChem CID 66657549) has the molecular formula C27H25N3O7 and a molecular weight of 503.51 g/mol. Its IUPAC name is 2-(carboxymethyl)-5-[(5-carboxy-2-pyridinyl)oxy]-1-[4-(diethylamino)phenyl]indole-3-carboxylic acid.
| Compound Name | 2-(carboxymethyl)-5-[(5-carboxy-2-pyridinyl)oxy]-1-[4-(diethylamino)phenyl]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 66657549 |
| Molecular Formula | C27H25N3O7 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 2-(carboxymethyl)-5-[(5-carboxy-2-pyridinyl)oxy]-1-[4-(diethylamino)phenyl]indole-3-carboxylic acid |
| SMILES | CCN(CC)c1ccc(-n2c(CC(=O)O)c(C(=O)O)c3cc(Oc4ccc(C(=O)O)cn4)ccc32)cc1 |
| InChI | InChI=1S/C27H25N3O7/c1-3-29(4-2)17-6-8-18(9-7-17)30-21-11-10-19(37-23-12-5-16(15-28-23)26(33)34)13-20(21)25(27(35)36)22(30)14-24(31)32/h5-13,15H,3-4,14H2,1-2H3,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | WMOPUZWOLNYGNT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|