C20H18Br2O5 — CID 6666401
(4aS,8R,8aR)-3,8a-dibromo-7-ethenyl-8-(4-hydroxy-3,5-dimethoxyphenyl)-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 6666401) has the molecular formula C20H18Br2O5 and a molecular weight of 498.17 g/mol. Its IUPAC name is (4aS,8R,8aR)-3,8a-dibromo-7-ethenyl-8-(4-hydroxy-3,5-dimethoxyphenyl)-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | (4aS,8R,8aR)-3,8a-dibromo-7-ethenyl-8-(4-hydroxy-3,5-dimethoxyphenyl)-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 6666401 |
| Molecular Formula | C20H18Br2O5 |
| Molecular Weight | 498.17 g/mol |
| Exact Mass | 495.95 |
| IUPAC Name | (4aS,8R,8aR)-3,8a-dibromo-7-ethenyl-8-(4-hydroxy-3,5-dimethoxyphenyl)-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | C=CC1=CC[C@H]2C(=O)C(Br)=CC(=O)[C@@]2(Br)[C@H]1c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C20H18Br2O5/c1-4-10-5-6-12-18(24)13(21)9-16(23)20(12,22)17(10)11-7-14(26-2)19(25)15(8-11)27-3/h4-5,7-9,12,17,25H,1,6H2,2-3H3/t12-,17+,20+/m0/s1 |
| InChIKey | VKZKOHQYVCTZRU-LCIZUOBNSA-N |
| XLogP | 4.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.17 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|