C19H14Br4O4 — CID 6666406
(4aS,8R,8aR)-3,8a-dibromo-8-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-7-ethenyl-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 6666406) has the molecular formula C19H14Br4O4 and a molecular weight of 625.93 g/mol. Its IUPAC name is (4aS,8R,8aR)-3,8a-dibromo-8-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-7-ethenyl-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | (4aS,8R,8aR)-3,8a-dibromo-8-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-7-ethenyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 6666406 |
| Molecular Formula | C19H14Br4O4 |
| Molecular Weight | 625.93 g/mol |
| Exact Mass | 621.76 |
| IUPAC Name | (4aS,8R,8aR)-3,8a-dibromo-8-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-7-ethenyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | C=CC1=CC[C@H]2C(=O)C(Br)=CC(=O)[C@@]2(Br)[C@H]1c1cc(OC)c(O)c(Br)c1Br |
| InChI | InChI=1S/C19H14Br4O4/c1-3-8-4-5-10-17(25)11(20)7-13(24)19(10,23)14(8)9-6-12(27-2)18(26)16(22)15(9)21/h3-4,6-7,10,14,26H,1,5H2,2H3/t10-,14+,19+/m0/s1 |
| InChIKey | ZTATZIUWPBIIGQ-PJZBOPKMSA-N |
| XLogP | 5.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.93 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|