C23H26O5 — CID 6637652
(4aR,8R,8aS)-7-ethenyl-8-(4-hydroxy-3,5-dimethoxyphenyl)-2,3,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 6637652) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is (4aR,8R,8aS)-7-ethenyl-8-(4-hydroxy-3,5-dimethoxyphenyl)-2,3,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | (4aR,8R,8aS)-7-ethenyl-8-(4-hydroxy-3,5-dimethoxyphenyl)-2,3,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 6637652 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (4aR,8R,8aS)-7-ethenyl-8-(4-hydroxy-3,5-dimethoxyphenyl)-2,3,8a-trimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | C=CC1=CC[C@H]2C(=O)C(C)=C(C)C(=O)[C@@]2(C)[C@H]1c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C23H26O5/c1-7-14-8-9-16-20(24)12(2)13(3)22(26)23(16,4)19(14)15-10-17(27-5)21(25)18(11-15)28-6/h7-8,10-11,16,19,25H,1,9H2,2-6H3/t16-,19+,23+/m0/s1 |
| InChIKey | UHHFYJMHTVPYPG-XKDCRVNJSA-N |
| XLogP | 4.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |