C12H9F3N2O2 — CID 66666207
5-pyridin-3-yl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide (PubChem CID 66666207) has the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. Its IUPAC name is 5-pyridin-3-yl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide.
| Compound Name | 5-pyridin-3-yl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 66666207 |
| Molecular Formula | C12H9F3N2O2 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 5-pyridin-3-yl-N-(2,2,2-trifluoroethyl)furan-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1coc(-c2cccnc2)c1 |
| InChI | InChI=1S/C12H9F3N2O2/c13-12(14,15)7-17-11(18)9-4-10(19-6-9)8-2-1-3-16-5-8/h1-6H,7H2,(H,17,18) |
| InChIKey | YGGMEIAMSVCCCT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |