C22H29N5O2 — CID 66667040
3-N,10-N-bis[2-(dimethylamino)ethyl]pyrido[1,2-a]indole-3,10-dicarboxamide (PubChem CID 66667040) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 3-N,10-N-bis[2-(dimethylamino)ethyl]pyrido[1,2-a]indole-3,10-dicarboxamide.
| Compound Name | 3-N,10-N-bis[2-(dimethylamino)ethyl]pyrido[1,2-a]indole-3,10-dicarboxamide |
|---|---|
| PubChem CID | 66667040 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 3-N,10-N-bis[2-(dimethylamino)ethyl]pyrido[1,2-a]indole-3,10-dicarboxamide |
| SMILES | CN(C)CCNC(=O)c1ccc2c(C(=O)NCCN(C)C)c3ccccn3c2c1 |
| InChI | InChI=1S/C22H29N5O2/c1-25(2)13-10-23-21(28)16-8-9-17-19(15-16)27-12-6-5-7-18(27)20(17)22(29)24-11-14-26(3)4/h5-9,12,15H,10-11,13-14H2,1-4H3,(H,23,28)(H,24,29) |
| InChIKey | JQKFHJZMXBFOIB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |