C22H26N2O4 — CID 66667334
2-(dimethylamino)ethyl 3-(4-methoxybutanoyl)pyrido[1,2-a]indole-10-carboxylate (PubChem CID 66667334) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 3-(4-methoxybutanoyl)pyrido[1,2-a]indole-10-carboxylate.
| Compound Name | 2-(dimethylamino)ethyl 3-(4-methoxybutanoyl)pyrido[1,2-a]indole-10-carboxylate |
|---|---|
| PubChem CID | 66667334 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-(dimethylamino)ethyl 3-(4-methoxybutanoyl)pyrido[1,2-a]indole-10-carboxylate |
| SMILES | COCCCC(=O)c1ccc2c(C(=O)OCCN(C)C)c3ccccn3c2c1 |
| InChI | InChI=1S/C22H26N2O4/c1-23(2)12-14-28-22(26)21-17-10-9-16(20(25)8-6-13-27-3)15-19(17)24-11-5-4-7-18(21)24/h4-5,7,9-11,15H,6,8,12-14H2,1-3H3 |
| InChIKey | DFVNTWNWURIOOX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|