C28H20O7 — CID 66672757
3',6'-dihydroxy-7-(phenylmethoxymethoxy)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 66672757) has the molecular formula C28H20O7 and a molecular weight of 468.46 g/mol. Its IUPAC name is 3',6'-dihydroxy-7-(phenylmethoxymethoxy)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-dihydroxy-7-(phenylmethoxymethoxy)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 66672757 |
| Molecular Formula | C28H20O7 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 3',6'-dihydroxy-7-(phenylmethoxymethoxy)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2cccc(OCOCc3ccccc3)c21 |
| InChI | InChI=1S/C28H20O7/c29-18-9-11-20-24(13-18)34-25-14-19(30)10-12-21(25)28(20)22-7-4-8-23(26(22)27(31)35-28)33-16-32-15-17-5-2-1-3-6-17/h1-14,29-30H,15-16H2 |
| InChIKey | PFONSQIEWDTZSP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|