C16H24FN3O4 — CID 66700314
(3-amino-2-hydroxypropyl)-(2-ethyl-3-fluoro-4-morpholin-4-ylphenyl)carbamic acid (PubChem CID 66700314) has the molecular formula C16H24FN3O4 and a molecular weight of 341.38 g/mol. Its IUPAC name is (3-amino-2-hydroxypropyl)-(2-ethyl-3-fluoro-4-morpholin-4-ylphenyl)carbamic acid.
| Compound Name | (3-amino-2-hydroxypropyl)-(2-ethyl-3-fluoro-4-morpholin-4-ylphenyl)carbamic acid |
|---|---|
| PubChem CID | 66700314 |
| Molecular Formula | C16H24FN3O4 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (3-amino-2-hydroxypropyl)-(2-ethyl-3-fluoro-4-morpholin-4-ylphenyl)carbamic acid |
| SMILES | CCc1c(N(CC(O)CN)C(=O)O)ccc(N2CCOCC2)c1F |
| InChI | InChI=1S/C16H24FN3O4/c1-2-12-13(20(16(22)23)10-11(21)9-18)3-4-14(15(12)17)19-5-7-24-8-6-19/h3-4,11,21H,2,5-10,18H2,1H3,(H,22,23) |
| InChIKey | MSOSIDIDODKDSG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|