C18H26N4O2S2 — CID 66702030
N-[2-benzylsulfanyl-6-[[(2R)-butan-2-yl]amino]pyrimidin-4-yl]propane-1-sulfonamide (PubChem CID 66702030) has the molecular formula C18H26N4O2S2 and a molecular weight of 394.57 g/mol. Its IUPAC name is N-[2-benzylsulfanyl-6-[[(2R)-butan-2-yl]amino]pyrimidin-4-yl]propane-1-sulfonamide.
| Compound Name | N-[2-benzylsulfanyl-6-[[(2R)-butan-2-yl]amino]pyrimidin-4-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 66702030 |
| Molecular Formula | C18H26N4O2S2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[2-benzylsulfanyl-6-[[(2R)-butan-2-yl]amino]pyrimidin-4-yl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1cc(N[C@H](C)CC)nc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C18H26N4O2S2/c1-4-11-26(23,24)22-17-12-16(19-14(3)5-2)20-18(21-17)25-13-15-9-7-6-8-10-15/h6-10,12,14H,4-5,11,13H2,1-3H3,(H2,19,20,21,22)/t14-/m1/s1 |
| InChIKey | QPAAAFWDDAZPIP-CQSZACIVSA-N |
| XLogP | 4.13 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |