C22H26N4OS2 — CID 142855101
(2R)-2-[[2-benzylsulfanyl-6-[(2,5-dimethylphenyl)sulfanylamino]pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 142855101) has the molecular formula C22H26N4OS2 and a molecular weight of 426.61 g/mol. Its IUPAC name is (2R)-2-[[2-benzylsulfanyl-6-[(2,5-dimethylphenyl)sulfanylamino]pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | (2R)-2-[[2-benzylsulfanyl-6-[(2,5-dimethylphenyl)sulfanylamino]pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 142855101 |
| Molecular Formula | C22H26N4OS2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (2R)-2-[[2-benzylsulfanyl-6-[(2,5-dimethylphenyl)sulfanylamino]pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | Cc1ccc(C)c(SNc2cc(N[C@H](C)CO)nc(SCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H26N4OS2/c1-15-9-10-16(2)19(11-15)29-26-21-12-20(23-17(3)13-27)24-22(25-21)28-14-18-7-5-4-6-8-18/h4-12,17,27H,13-14H2,1-3H3,(H2,23,24,25,26)/t17-/m1/s1 |
| InChIKey | OLTNPRSPRDHPEU-QGZVFWFLSA-N |
| XLogP | 5.30 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|