C15H20N4O5S2 — CID 174484154
[[2-benzylsulfanyl-6-(1,3-dihydroxypropan-2-ylamino)pyrimidin-4-yl]amino]methyl hydrogen sulfite (PubChem CID 174484154) has the molecular formula C15H20N4O5S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is [[2-benzylsulfanyl-6-(1,3-dihydroxypropan-2-ylamino)pyrimidin-4-yl]amino]methyl hydrogen sulfite.
| Compound Name | [[2-benzylsulfanyl-6-(1,3-dihydroxypropan-2-ylamino)pyrimidin-4-yl]amino]methyl hydrogen sulfite |
|---|---|
| PubChem CID | 174484154 |
| Molecular Formula | C15H20N4O5S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [[2-benzylsulfanyl-6-(1,3-dihydroxypropan-2-ylamino)pyrimidin-4-yl]amino]methyl hydrogen sulfite |
| SMILES | O=S(O)OCNc1cc(NC(CO)CO)nc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C15H20N4O5S2/c20-7-12(8-21)17-14-6-13(16-10-24-26(22)23)18-15(19-14)25-9-11-4-2-1-3-5-11/h1-6,12,20-21H,7-10H2,(H,22,23)(H2,16,17,18,19) |
| InChIKey | HYNNCSABQLTEER-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|