C20H22N4O3S2 — CID 142855067
N-[2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidin-4-yl]-4-methoxybenzenesulfinamide (PubChem CID 142855067) has the molecular formula C20H22N4O3S2 and a molecular weight of 430.56 g/mol. Its IUPAC name is N-[2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidin-4-yl]-4-methoxybenzenesulfinamide.
| Compound Name | N-[2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidin-4-yl]-4-methoxybenzenesulfinamide |
|---|---|
| PubChem CID | 142855067 |
| Molecular Formula | C20H22N4O3S2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N-[2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidin-4-yl]-4-methoxybenzenesulfinamide |
| SMILES | COc1ccc(S(=O)Nc2cc(NCCO)nc(SCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H22N4O3S2/c1-27-16-7-9-17(10-8-16)29(26)24-19-13-18(21-11-12-25)22-20(23-19)28-14-15-5-3-2-4-6-15/h2-10,13,25H,11-12,14H2,1H3,(H2,21,22,23,24) |
| InChIKey | OZFVVXRKEDIFTI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |