About methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate
methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate (PubChem CID 175241865) has the molecular formula C14H18N4O4S2
and a molecular weight of 370.46 g/mol. Its IUPAC name is methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate.
Molecular Properties
| Compound Name | methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate |
| PubChem CID | 175241865 |
| Molecular Formula | C14H18N4O4S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate |
| SMILES | CNOS(=O)(=O)c1cc(NCCO)nc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C14H18N4O4S2/c1-15-22-24(20,21)13-9-12(16-7-8-19)17-14(18-13)23-10-11-5-3-2-4-6-11/h2-6,9,15,19H,7-8,10H2,1H3,(H,16,17,18) |
| InChIKey | WOJSHIZTPOUIIF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate?
The IUPAC name of methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate (CID 175241865) is methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate.
What is the SMILES notation for methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate?
The canonical SMILES for methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate is CNOS(=O)(=O)c1cc(NCCO)nc(SCc2ccccc2)n1.
What is the InChIKey of methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate?
The InChIKey is WOJSHIZTPOUIIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O4S2/c1-15-22-24(20,21)13-9-12(16-7-8-19)17-14(18-13)23-10-11-5-3-2-4-6-11/h2-6,9,15,19H,7-8,10H2,1H3,(H,16,17,18).
What are the key properties of methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate?
methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate has a molecular weight of 370.46 g/mol, XLogP of 1.01, 9 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methylamino 2-benzylsulfanyl-6-(2-hydroxyethylamino)pyrimidine-4-sulfonate is sourced from PubChem (CID 175241865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).