C19H30ClNO — CID 66702546
(3S,5S)-1-[3-[3-(4-chlorophenyl)propoxy]propyl]-3,5-dimethylpiperidine (PubChem CID 66702546) has the molecular formula C19H30ClNO and a molecular weight of 323.91 g/mol. Its IUPAC name is (3S,5S)-1-[3-[3-(4-chlorophenyl)propoxy]propyl]-3,5-dimethylpiperidine.
| Compound Name | (3S,5S)-1-[3-[3-(4-chlorophenyl)propoxy]propyl]-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 66702546 |
| Molecular Formula | C19H30ClNO |
| Molecular Weight | 323.91 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (3S,5S)-1-[3-[3-(4-chlorophenyl)propoxy]propyl]-3,5-dimethylpiperidine |
| SMILES | C[C@H]1C[C@H](C)CN(CCCOCCCc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H30ClNO/c1-16-13-17(2)15-21(14-16)10-4-12-22-11-3-5-18-6-8-19(20)9-7-18/h6-9,16-17H,3-5,10-15H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | ULKGYZJGSVUTSE-IRXDYDNUSA-N |
| XLogP | 4.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.91 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|