C19H27ClFNO2 — CID 66708690
(8R,9S,10S,13S,14S)-17-amino-9-chloro-16-fluoro-10,13-dimethyl-3,4,5,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,7-diol (PubChem CID 66708690) has the molecular formula C19H27ClFNO2 and a molecular weight of 355.88 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-17-amino-9-chloro-16-fluoro-10,13-dimethyl-3,4,5,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (8R,9S,10S,13S,14S)-17-amino-9-chloro-16-fluoro-10,13-dimethyl-3,4,5,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 66708690 |
| Molecular Formula | C19H27ClFNO2 |
| Molecular Weight | 355.88 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (8R,9S,10S,13S,14S)-17-amino-9-chloro-16-fluoro-10,13-dimethyl-3,4,5,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,7-diol |
| SMILES | C[C@]12C=CC(O)CC1C=C(O)[C@H]1[C@@H]3CC(F)C(N)[C@@]3(C)CC[C@]12Cl |
| InChI | InChI=1S/C19H27ClFNO2/c1-17-5-6-19(20)15(12(17)9-13(21)16(17)22)14(24)8-10-7-11(23)3-4-18(10,19)2/h3-4,8,10-13,15-16,23-24H,5-7,9,22H2,1-2H3/t10?,11?,12-,13?,15+,16?,17-,18-,19-/m0/s1 |
| InChIKey | SSRGMDTZTAAJPA-SSYOCFIJSA-N |
| XLogP | 3.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|