C19H28ClNO2 — CID 69493837
(8S,9R,10S,13S,14S,17S)-17-amino-9-chloro-10,13-dimethyl-5,8,11,12,14,15,16,17-octahydro-4H-cyclopenta[a]phenanthrene-3,3-diol (PubChem CID 69493837) has the molecular formula C19H28ClNO2 and a molecular weight of 337.89 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S,17S)-17-amino-9-chloro-10,13-dimethyl-5,8,11,12,14,15,16,17-octahydro-4H-cyclopenta[a]phenanthrene-3,3-diol.
| Compound Name | (8S,9R,10S,13S,14S,17S)-17-amino-9-chloro-10,13-dimethyl-5,8,11,12,14,15,16,17-octahydro-4H-cyclopenta[a]phenanthrene-3,3-diol |
|---|---|
| PubChem CID | 69493837 |
| Molecular Formula | C19H28ClNO2 |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (8S,9R,10S,13S,14S,17S)-17-amino-9-chloro-10,13-dimethyl-5,8,11,12,14,15,16,17-octahydro-4H-cyclopenta[a]phenanthrene-3,3-diol |
| SMILES | C[C@]12CC[C@@]3(Cl)[C@@H](C=CC4CC(O)(O)C=C[C@@]43C)[C@@H]1CC[C@@H]2N |
| InChI | InChI=1S/C19H28ClNO2/c1-16-7-10-19(20)14(13(16)5-6-15(16)21)4-3-12-11-18(22,23)9-8-17(12,19)2/h3-4,8-9,12-15,22-23H,5-7,10-11,21H2,1-2H3/t12?,13-,14-,15-,16-,17-,19+/m0/s1 |
| InChIKey | BAHBQOWZLOELCG-HDNIKMQMSA-N |
| XLogP | 2.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|