C19H27ClO3 — CID 69457535
(8S,9R,10R,13S,14S)-9-chloro-10,13-dimethyl-5,8,11,12,14,15,16,17-octahydro-4H-cyclopenta[a]phenanthrene-2,3,3-triol (PubChem CID 69457535) has the molecular formula C19H27ClO3 and a molecular weight of 338.88 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-9-chloro-10,13-dimethyl-5,8,11,12,14,15,16,17-octahydro-4H-cyclopenta[a]phenanthrene-2,3,3-triol.
| Compound Name | (8S,9R,10R,13S,14S)-9-chloro-10,13-dimethyl-5,8,11,12,14,15,16,17-octahydro-4H-cyclopenta[a]phenanthrene-2,3,3-triol |
|---|---|
| PubChem CID | 69457535 |
| Molecular Formula | C19H27ClO3 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (8S,9R,10R,13S,14S)-9-chloro-10,13-dimethyl-5,8,11,12,14,15,16,17-octahydro-4H-cyclopenta[a]phenanthrene-2,3,3-triol |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1C=CC3CC(O)(O)C(O)=C[C@]3(C)[C@@]1(Cl)CC2 |
| InChI | InChI=1S/C19H27ClO3/c1-16-7-3-4-13(16)14-6-5-12-10-19(22,23)15(21)11-17(12,2)18(14,20)9-8-16/h5-6,11-14,21-23H,3-4,7-10H2,1-2H3/t12?,13-,14-,16-,17-,18+/m0/s1 |
| InChIKey | AOSIGSCKTRQBMP-DNQRXAAZSA-N |
| XLogP | 3.90 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|