C29H37FN2O6Si — CID 66720265
CID 66720265 (PubChem CID 66720265) has the molecular formula C29H37FN2O6Si and a molecular weight of 556.71 g/mol.
| Compound Name | CID 66720265 |
|---|---|
| PubChem CID | 66720265 |
| Molecular Formula | C29H37FN2O6Si |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)[C@H]1CN(c2ccc(OCC3CCN(C(=O)OCc4ccccc4)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C29H37FN2O6Si/c1-28(2,3)39-38-29(4,5)25-17-32(27(34)37-25)22-11-12-24(23(30)15-22)35-19-21-13-14-31(16-21)26(33)36-18-20-9-7-6-8-10-20/h6-12,15,21,25H,13-14,16-19H2,1-5H3/t21?,25-/m1/s1 |
| InChIKey | ANBVPOZJYBIJGN-UIDYPRJRSA-N |
| XLogP | 5.82 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|