C26H42N2O4 — CID 66726661
[2,2-dimethyl-5-[(7-octyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)methyl]-1,3-dioxan-5-yl]carbamic acid (PubChem CID 66726661) has the molecular formula C26H42N2O4 and a molecular weight of 446.63 g/mol. Its IUPAC name is [2,2-dimethyl-5-[(7-octyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)methyl]-1,3-dioxan-5-yl]carbamic acid.
| Compound Name | [2,2-dimethyl-5-[(7-octyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)methyl]-1,3-dioxan-5-yl]carbamic acid |
|---|---|
| PubChem CID | 66726661 |
| Molecular Formula | C26H42N2O4 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.31 |
| IUPAC Name | [2,2-dimethyl-5-[(7-octyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)methyl]-1,3-dioxan-5-yl]carbamic acid |
| SMILES | CCCCCCCCc1ccc2c(c1)CCN(CC1(NC(=O)O)COC(C)(C)OC1)CC2 |
| InChI | InChI=1S/C26H42N2O4/c1-4-5-6-7-8-9-10-21-11-12-22-13-15-28(16-14-23(22)17-21)18-26(27-24(29)30)19-31-25(2,3)32-20-26/h11-12,17,27H,4-10,13-16,18-20H2,1-3H3,(H,29,30) |
| InChIKey | MZICBKCDXYPFGH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|