About 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole
4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole (PubChem CID 66728317) has the molecular formula C6H2Br2N2S2
and a molecular weight of 326.04 g/mol. Its IUPAC name is 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole |
| PubChem CID | 66728317 |
| Molecular Formula | C6H2Br2N2S2 |
| Molecular Weight | 326.04 g/mol |
| Exact Mass | 323.80 |
| IUPAC Name | 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole |
| SMILES | Brc1ncsc1-c1scnc1Br |
| InChI | InChI=1S/C6H2Br2N2S2/c7-5-3(11-1-9-5)4-6(8)10-2-12-4/h1-2H |
| InChIKey | XRLLAFRUWXQXKE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.04 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole?
The IUPAC name of 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole (CID 66728317) is 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole.
What is the SMILES notation for 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole?
The canonical SMILES for 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole is Brc1ncsc1-c1scnc1Br.
What is the InChIKey of 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole?
The InChIKey is XRLLAFRUWXQXKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Br2N2S2/c7-5-3(11-1-9-5)4-6(8)10-2-12-4/h1-2H.
What are the key properties of 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole?
4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole has a molecular weight of 326.04 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole is sourced from PubChem (CID 66728317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).