C5H2N2O2S — CID 18442733
pyrrolo[3,4-d][1,3]thiazole-4,6-dione (PubChem CID 18442733) has the molecular formula C5H2N2O2S and a molecular weight of 154.15 g/mol. Its IUPAC name is pyrrolo[3,4-d][1,3]thiazole-4,6-dione.
| Compound Name | pyrrolo[3,4-d][1,3]thiazole-4,6-dione |
|---|---|
| PubChem CID | 18442733 |
| Molecular Formula | C5H2N2O2S |
| Molecular Weight | 154.15 g/mol |
| Exact Mass | 153.98 |
| IUPAC Name | pyrrolo[3,4-d][1,3]thiazole-4,6-dione |
| SMILES | O=C1NC(=O)c2scnc21 |
| InChI | InChI=1S/C5H2N2O2S/c8-4-2-3(5(9)7-4)10-1-6-2/h1H,(H,7,8,9) |
| InChIKey | OYKUMLNMYNHCHY-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.15 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|